C14H15ClNO3- — CID 4744720
2-[(3-chlorophenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 4744720) has the molecular formula C14H15ClNO3- and a molecular weight of 280.73 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | 2-[(3-chlorophenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4744720 |
| Molecular Formula | C14H15ClNO3- |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1CCCCC1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClNO3/c15-9-4-3-5-10(8-9)16-13(17)11-6-1-2-7-12(11)14(18)19/h3-5,8,11-12H,1-2,6-7H2,(H,16,17)(H,18,19)/p-1 |
| InChIKey | IASQCMHOTKBIGQ-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |