C14H15FNO3- — CID 6592948
trans-(1S,2S)-2-[(3-fluorophenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6592948) has the molecular formula C14H15FNO3- and a molecular weight of 264.28 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(3-fluorophenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-[(3-fluorophenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6592948 |
| Molecular Formula | C14H15FNO3- |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | trans-(1S,2S)-2-[(3-fluorophenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCC[C@@H]1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H16FNO3/c15-9-4-3-5-10(8-9)16-13(17)11-6-1-2-7-12(11)14(18)19/h3-5,8,11-12H,1-2,6-7H2,(H,16,17)(H,18,19)/p-1/t11-,12-/m0/s1 |
| InChIKey | HFIGTVJVIXQVDY-RYUDHWBXSA-M |
| XLogP | 1.32 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |