C24H22NO4- — CID 6974630
cis-(1R,2S)-2-[(4-naphthalen-2-yloxyphenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6974630) has the molecular formula C24H22NO4- and a molecular weight of 388.44 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(4-naphthalen-2-yloxyphenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-[(4-naphthalen-2-yloxyphenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6974630 |
| Molecular Formula | C24H22NO4- |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | cis-(1R,2S)-2-[(4-naphthalen-2-yloxyphenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | O=C(Nc1ccc(Oc2ccc3ccccc3c2)cc1)[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C24H23NO4/c26-23(21-7-3-4-8-22(21)24(27)28)25-18-10-13-19(14-11-18)29-20-12-9-16-5-1-2-6-17(16)15-20/h1-2,5-6,9-15,21-22H,3-4,7-8H2,(H,25,26)(H,27,28)/p-1/t21-,22+/m0/s1 |
| InChIKey | COWVJZMSQNLITM-FCHUYYIVSA-M |
| XLogP | 4.13 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |