C16H17INO3- — CID 7214574
(1S,6R)-6-[(4-iodophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7214574) has the molecular formula C16H17INO3- and a molecular weight of 398.22 g/mol. Its IUPAC name is (1S,6R)-6-[(4-iodophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[(4-iodophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7214574 |
| Molecular Formula | C16H17INO3- |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (1S,6R)-6-[(4-iodophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)C[C@@H](C(=O)Nc2ccc(I)cc2)[C@@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C16H18INO3/c1-9-7-13(14(16(20)21)8-10(9)2)15(19)18-12-5-3-11(17)4-6-12/h3-6,13-14H,7-8H2,1-2H3,(H,18,19)(H,20,21)/p-1/t13-,14+/m1/s1 |
| InChIKey | KTSLUZPORMHNPS-KGLIPLIRSA-M |
| XLogP | 2.34 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|