C17H20NO4- — CID 7438847
(1S,6R)-6-[(4-methoxyphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7438847) has the molecular formula C17H20NO4- and a molecular weight of 302.35 g/mol. Its IUPAC name is (1S,6R)-6-[(4-methoxyphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-[(4-methoxyphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7438847 |
| Molecular Formula | C17H20NO4- |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (1S,6R)-6-[(4-methoxyphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC(C)=C(C)C[C@@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H21NO4/c1-10-8-14(15(17(20)21)9-11(10)2)16(19)18-12-4-6-13(22-3)7-5-12/h4-7,14-15H,8-9H2,1-3H3,(H,18,19)(H,20,21)/p-1/t14-,15+/m1/s1 |
| InChIKey | MMZUCRRTSASPKO-CABCVRRESA-M |
| XLogP | 1.75 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|