C15H19NO2 — CID 100939210
(1R,2R)-N-(4-methoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 100939210) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1R,2R)-N-(4-methoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R)-N-(4-methoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 100939210 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1R,2R)-N-(4-methoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-18-13-6-4-12(5-7-13)16-15(17)14-9-10-2-3-11(14)8-10/h4-7,10-11,14H,2-3,8-9H2,1H3,(H,16,17)/t10?,11-,14-/m1/s1 |
| InChIKey | LCBYFNBVQMOBMR-MDLDFJCZSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |