C16H21NO2 — CID 7101788
(1S,2S,4S)-N-(4-ethoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 7101788) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (1S,2S,4S)-N-(4-ethoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-(4-ethoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 7101788 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (1S,2S,4S)-N-(4-ethoxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2C[C@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C16H21NO2/c1-2-19-14-7-5-13(6-8-14)17-16(18)15-10-11-3-4-12(15)9-11/h5-8,11-12,15H,2-4,9-10H2,1H3,(H,17,18)/t11-,12-,15-/m0/s1 |
| InChIKey | SIUMOAMTBCIDJR-HUBLWGQQSA-N |
| XLogP | 3.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |