C23H30N3O4- — CID 7428617
(1S,6S)-6-[[4-(cyclohexylcarbamoylamino)phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7428617) has the molecular formula C23H30N3O4- and a molecular weight of 412.51 g/mol. Its IUPAC name is (1S,6S)-6-[[4-(cyclohexylcarbamoylamino)phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[[4-(cyclohexylcarbamoylamino)phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7428617 |
| Molecular Formula | C23H30N3O4- |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (1S,6S)-6-[[4-(cyclohexylcarbamoylamino)phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)C[C@H](C(=O)Nc2ccc(NC(=O)NC3CCCCC3)cc2)[C@@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C23H31N3O4/c1-14-12-19(20(22(28)29)13-15(14)2)21(27)24-17-8-10-18(11-9-17)26-23(30)25-16-6-4-3-5-7-16/h8-11,16,19-20H,3-7,12-13H2,1-2H3,(H,24,27)(H,28,29)(H2,25,26,30)/p-1/t19-,20-/m0/s1 |
| InChIKey | TUDXFVSBNYXLLX-PMACEKPBSA-M |
| XLogP | 3.19 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|