C19H22NO5- — CID 7371135
(1S,6S)-6-[(4-ethoxycarbonylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7371135) has the molecular formula C19H22NO5- and a molecular weight of 344.39 g/mol. Its IUPAC name is (1S,6S)-6-[(4-ethoxycarbonylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[(4-ethoxycarbonylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7371135 |
| Molecular Formula | C19H22NO5- |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (1S,6S)-6-[(4-ethoxycarbonylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H]2CC(C)=C(C)C[C@@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H23NO5/c1-4-25-19(24)13-5-7-14(8-6-13)20-17(21)15-9-11(2)12(3)10-16(15)18(22)23/h5-8,15-16H,4,9-10H2,1-3H3,(H,20,21)(H,22,23)/p-1/t15-,16-/m0/s1 |
| InChIKey | RCLVXILSHQBSON-HOTGVXAUSA-M |
| XLogP | 1.91 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|