C17H19N2O4- — CID 7452806
(1S,6S)-6-[(4-carbamoylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 7452806) has the molecular formula C17H19N2O4- and a molecular weight of 315.35 g/mol. Its IUPAC name is (1S,6S)-6-[(4-carbamoylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[(4-carbamoylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7452806 |
| Molecular Formula | C17H19N2O4- |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (1S,6S)-6-[(4-carbamoylphenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)C[C@H](C(=O)Nc2ccc(C(N)=O)cc2)[C@@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C17H20N2O4/c1-9-7-13(14(17(22)23)8-10(9)2)16(21)19-12-5-3-11(4-6-12)15(18)20/h3-6,13-14H,7-8H2,1-2H3,(H2,18,20)(H,19,21)(H,22,23)/p-1/t13-,14-/m0/s1 |
| InChIKey | GCDJCSFKJZMGGT-KBPBESRZSA-M |
| XLogP | 0.84 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|