C19H24NO3- — CID 4744743
3,4-dimethyl-6-[(4-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 4744743) has the molecular formula C19H24NO3- and a molecular weight of 314.41 g/mol. Its IUPAC name is 3,4-dimethyl-6-[(4-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 3,4-dimethyl-6-[(4-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4744743 |
| Molecular Formula | C19H24NO3- |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 3,4-dimethyl-6-[(4-propan-2-ylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)CC(C(=O)Nc2ccc(C(C)C)cc2)C(C(=O)[O-])C1 |
| InChI | InChI=1S/C19H25NO3/c1-11(2)14-5-7-15(8-6-14)20-18(21)16-9-12(3)13(4)10-17(16)19(22)23/h5-8,11,16-17H,9-10H2,1-4H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | CUMYYBACRQOPSC-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|