C18H21N3O5S — CID 108789805
1-(3,4-dimethoxyphenyl)sulfonyl-N-pyridin-3-ylpyrrolidine-2-carboxamide (PubChem CID 108789805) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-N-pyridin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-pyridin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 108789805 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-pyridin-3-ylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2cccnc2)cc1OC |
| InChI | InChI=1S/C18H21N3O5S/c1-25-16-8-7-14(11-17(16)26-2)27(23,24)21-10-4-6-15(21)18(22)20-13-5-3-9-19-12-13/h3,5,7-9,11-12,15H,4,6,10H2,1-2H3,(H,20,22) |
| InChIKey | UGRKRYFMIMKRPM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |