C20H22N2O7S — CID 108789701
3-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoic acid (PubChem CID 108789701) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is 3-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108789701 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 3-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2cccc(C(=O)O)c2)cc1OC |
| InChI | InChI=1S/C20H22N2O7S/c1-28-17-9-8-15(12-18(17)29-2)30(26,27)22-10-4-7-16(22)19(23)21-14-6-3-5-13(11-14)20(24)25/h3,5-6,8-9,11-12,16H,4,7,10H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | TVOUMRBGOUIDAJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |