C25H27N3O5S — CID 108789803
N-(4-anilinophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 108789803) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is N-(4-anilinophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(4-anilinophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 108789803 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-(4-anilinophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2ccc(Nc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H27N3O5S/c1-32-23-15-14-21(17-24(23)33-2)34(30,31)28-16-6-9-22(28)25(29)27-20-12-10-19(11-13-20)26-18-7-4-3-5-8-18/h3-5,7-8,10-15,17,22,26H,6,9,16H2,1-2H3,(H,27,29) |
| InChIKey | FZRSANFSQABALP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |