C19H21BrN2O5S — CID 18846716
N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 18846716) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18846716 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | N-(4-bromophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C19H21BrN2O5S/c1-26-17-10-9-15(12-18(17)27-2)28(24,25)22-11-3-4-16(22)19(23)21-14-7-5-13(20)6-8-14/h5-10,12,16H,3-4,11H2,1-2H3,(H,21,23) |
| InChIKey | ULVRVIIDVRNLSU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |