C17H24N2O7S — CID 108789751
4-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 108789751) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108789751 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-[[1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2C(=O)NCCCC(=O)O)cc1OC |
| InChI | InChI=1S/C17H24N2O7S/c1-25-14-8-7-12(11-15(14)26-2)27(23,24)19-10-4-5-13(19)17(22)18-9-3-6-16(20)21/h7-8,11,13H,3-6,9-10H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | CSNJXSJUGSFEAK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|