C16H24N2O6S — CID 108789725
1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 108789725) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 108789725 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)C1CCCN1S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O6S/c1-22-10-8-17-16(19)13-5-4-9-18(13)25(20,21)12-6-7-14(23-2)15(11-12)24-3/h6-7,11,13H,4-5,8-10H2,1-3H3,(H,17,19) |
| InChIKey | RAKFHOHPPXYQBF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|