C17H17FN4O2 — CID 124623266
1-[(3S)-1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-3-pyridin-3-ylurea (PubChem CID 124623266) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 1-[(3S)-1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-3-pyridin-3-ylurea.
| Compound Name | 1-[(3S)-1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 124623266 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[(3S)-1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)N[C@H]1CCN(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H17FN4O2/c18-13-5-3-12(4-6-13)11-22-9-7-15(16(22)23)21-17(24)20-14-2-1-8-19-10-14/h1-6,8,10,15H,7,9,11H2,(H2,20,21,24)/t15-/m0/s1 |
| InChIKey | BYKFOATXGBRLEP-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |