C19H30Cl2N4O2 — CID 119885308
N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119885308) has the molecular formula C19H30Cl2N4O2 and a molecular weight of 417.38 g/mol. Its IUPAC name is N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119885308 |
| Molecular Formula | C19H30Cl2N4O2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CN(C)CC(=O)Nc1ccc(NC(=O)C2CC3CCCCC3N2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H28N4O2.2ClH/c1-23(2)12-18(24)20-14-7-9-15(10-8-14)21-19(25)17-11-13-5-3-4-6-16(13)22-17;;/h7-10,13,16-17,22H,3-6,11-12H2,1-2H3,(H,20,24)(H,21,25);2*1H |
| InChIKey | LJSLXUCKMGLSJZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |