C18H25ClN2O4 — CID 119283536
methyl 2-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)phenoxy]acetate;hydrochloride (PubChem CID 119283536) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is methyl 2-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)phenoxy]acetate;hydrochloride.
| Compound Name | methyl 2-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)phenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 119283536 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 2-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)phenoxy]acetate;hydrochloride |
| SMILES | COC(=O)COc1ccc(NC(=O)C2CC3CCCCC3N2)cc1.Cl |
| InChI | InChI=1S/C18H24N2O4.ClH/c1-23-17(21)11-24-14-8-6-13(7-9-14)19-18(22)16-10-12-4-2-3-5-15(12)20-16;/h6-9,12,15-16,20H,2-5,10-11H2,1H3,(H,19,22);1H |
| InChIKey | JNISHKDTYDTZLY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |