C16H22BrClN2O2 — CID 119290156
N-(4-bromo-3-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119290156) has the molecular formula C16H22BrClN2O2 and a molecular weight of 389.72 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119290156 |
| Molecular Formula | C16H22BrClN2O2 |
| Molecular Weight | 389.72 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COc1cc(NC(=O)C2CC3CCCCC3N2)ccc1Br.Cl |
| InChI | InChI=1S/C16H21BrN2O2.ClH/c1-21-15-9-11(6-7-12(15)17)18-16(20)14-8-10-4-2-3-5-13(10)19-14;/h6-7,9-10,13-14,19H,2-5,8H2,1H3,(H,18,20);1H |
| InChIKey | MJMORKXXBHWQAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |