C19H29ClN2O4 — CID 119289352
N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119289352) has the molecular formula C19H29ClN2O4 and a molecular weight of 384.90 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119289352 |
| Molecular Formula | C19H29ClN2O4 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COCCOc1cc(NC(=O)C2CC3CCCCC3N2)ccc1OC.Cl |
| InChI | InChI=1S/C19H28N2O4.ClH/c1-23-9-10-25-18-12-14(7-8-17(18)24-2)20-19(22)16-11-13-5-3-4-6-15(13)21-16;/h7-8,12-13,15-16,21H,3-6,9-11H2,1-2H3,(H,20,22);1H |
| InChIKey | SWTYQTHDQMWLAH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|