C18H25ClN6O2 — CID 119313704
N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119313704) has the molecular formula C18H25ClN6O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119313704 |
| Molecular Formula | C18H25ClN6O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C2CC3CCCCC3N2)cc1-n1nnnc1C.Cl |
| InChI | InChI=1S/C18H24N6O2.ClH/c1-11-21-22-23-24(11)16-10-13(7-8-17(16)26-2)19-18(25)15-9-12-5-3-4-6-14(12)20-15;/h7-8,10,12,14-15,20H,3-6,9H2,1-2H3,(H,19,25);1H |
| InChIKey | DFAOIRLLGIHGFE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |