C17H23ClN6O — CID 119276450
N-[3-(1-methyltetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119276450) has the molecular formula C17H23ClN6O and a molecular weight of 362.87 g/mol. Its IUPAC name is N-[3-(1-methyltetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(1-methyltetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119276450 |
| Molecular Formula | C17H23ClN6O |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[3-(1-methyltetrazol-5-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1nnnc1-c1cccc(NC(=O)C2CC3CCCCC3N2)c1 |
| InChI | InChI=1S/C17H22N6O.ClH/c1-23-16(20-21-22-23)12-6-4-7-13(9-12)18-17(24)15-10-11-5-2-3-8-14(11)19-15;/h4,6-7,9,11,14-15,19H,2-3,5,8,10H2,1H3,(H,18,24);1H |
| InChIKey | SHYVRXUWDAHCLF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |