C21H23N7O2 — CID 47033241
1-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 47033241) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 1-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 47033241 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)N2CCCC(C(=O)Nc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H23N7O2/c1-27-19(24-25-26-27)15-7-5-11-18(13-15)23-21(30)28-12-6-8-16(14-28)20(29)22-17-9-3-2-4-10-17/h2-5,7,9-11,13,16H,6,8,12,14H2,1H3,(H,22,29)(H,23,30) |
| InChIKey | WRLCZRICDJNZNM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |