C19H20N6O2S — CID 46422022
N-[3-(1-methyltetrazol-5-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 46422022) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[3-(1-methyltetrazol-5-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[3-(1-methyltetrazol-5-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46422022 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[3-(1-methyltetrazol-5-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)C2CCCN(C(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C19H20N6O2S/c1-24-17(21-22-23-24)13-5-2-7-15(11-13)20-18(26)14-6-3-9-25(12-14)19(27)16-8-4-10-28-16/h2,4-5,7-8,10-11,14H,3,6,9,12H2,1H3,(H,20,26) |
| InChIKey | ZUMKNKANRROSCP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |