C17H21N5O2S — CID 46557972
N'-(4,6-dimethylpyrimidin-2-yl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide (PubChem CID 46557972) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46557972 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)C2CCCN(C(=O)c3cccs3)C2)n1 |
| InChI | InChI=1S/C17H21N5O2S/c1-11-9-12(2)19-17(18-11)21-20-15(23)13-5-3-7-22(10-13)16(24)14-6-4-8-25-14/h4,6,8-9,13H,3,5,7,10H2,1-2H3,(H,20,23)(H,18,19,21) |
| InChIKey | LOTVJZFNJVZKMW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|