C18H18F3N3O2S — CID 39982573
(3S)-1-(thiophene-2-carbonyl)-N'-[2-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide (PubChem CID 39982573) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is (3S)-1-(thiophene-2-carbonyl)-N'-[2-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide.
| Compound Name | (3S)-1-(thiophene-2-carbonyl)-N'-[2-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 39982573 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (3S)-1-(thiophene-2-carbonyl)-N'-[2-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide |
| SMILES | O=C(NNc1ccccc1C(F)(F)F)[C@H]1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H18F3N3O2S/c19-18(20,21)13-6-1-2-7-14(13)22-23-16(25)12-5-3-9-24(11-12)17(26)15-8-4-10-27-15/h1-2,4,6-8,10,12,22H,3,5,9,11H2,(H,23,25)/t12-/m0/s1 |
| InChIKey | CWWPOAGMCQOUKQ-LBPRGKRZSA-N |
| XLogP | 3.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|