C18H23F3N2O2S — CID 30787670
(3R)-1-(thiophene-2-carbonyl)-N-[4-(trifluoromethyl)cyclohexyl]piperidine-3-carboxamide (PubChem CID 30787670) has the molecular formula C18H23F3N2O2S and a molecular weight of 388.46 g/mol. Its IUPAC name is (3R)-1-(thiophene-2-carbonyl)-N-[4-(trifluoromethyl)cyclohexyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(thiophene-2-carbonyl)-N-[4-(trifluoromethyl)cyclohexyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 30787670 |
| Molecular Formula | C18H23F3N2O2S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (3R)-1-(thiophene-2-carbonyl)-N-[4-(trifluoromethyl)cyclohexyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCC(C(F)(F)F)CC1)[C@@H]1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H23F3N2O2S/c19-18(20,21)13-5-7-14(8-6-13)22-16(24)12-3-1-9-23(11-12)17(25)15-4-2-10-26-15/h2,4,10,12-14H,1,3,5-9,11H2,(H,22,24)/t12-,13?,14?/m1/s1 |
| InChIKey | QHTKYGMCBGIATH-IYXRBSQSSA-N |
| XLogP | 3.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |