C19H18F6N4O — CID 55718313
N'-[2-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide (PubChem CID 55718313) has the molecular formula C19H18F6N4O and a molecular weight of 432.37 g/mol. Its IUPAC name is N'-[2-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide.
| Compound Name | N'-[2-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55718313 |
| Molecular Formula | C19H18F6N4O |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N'-[2-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide |
| SMILES | O=C(NNc1ccccc1C(F)(F)F)C1CCCN(c2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C19H18F6N4O/c20-18(21,22)13-6-1-2-8-15(13)27-28-17(30)12-5-4-10-29(11-12)16-14(19(23,24)25)7-3-9-26-16/h1-3,6-9,12,27H,4-5,10-11H2,(H,28,30) |
| InChIKey | XSNUUCWEZSJMQT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|