C18H15F6N3O — CID 51955026
(3S)-1-[3-(trifluoromethyl)-2-pyridinyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide (PubChem CID 51955026) has the molecular formula C18H15F6N3O and a molecular weight of 403.33 g/mol. Its IUPAC name is (3S)-1-[3-(trifluoromethyl)-2-pyridinyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[3-(trifluoromethyl)-2-pyridinyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51955026 |
| Molecular Formula | C18H15F6N3O |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (3S)-1-[3-(trifluoromethyl)-2-pyridinyl]-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)[C@H]1CCCN(c2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H15F6N3O/c19-12-5-6-13(15(21)14(12)20)26-17(28)10-3-2-8-27(9-10)16-11(18(22,23)24)4-1-7-25-16/h1,4-7,10H,2-3,8-9H2,(H,26,28)/t10-/m0/s1 |
| InChIKey | BQVANZBKCAFYDF-JTQLQIEISA-N |
| XLogP | 4.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|