C19H19F3IN3O — CID 55712610
N-(4-iodo-2-methylphenyl)-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 55712610) has the molecular formula C19H19F3IN3O and a molecular weight of 489.28 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55712610 |
| Molecular Formula | C19H19F3IN3O |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C1CCCN(c2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C19H19F3IN3O/c1-12-10-14(23)6-7-16(12)25-18(27)13-4-3-9-26(11-13)17-15(19(20,21)22)5-2-8-24-17/h2,5-8,10,13H,3-4,9,11H2,1H3,(H,25,27) |
| InChIKey | VALSJJXEFIWWEV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|