C22H25F3N4O4 — CID 55712443
N'-[2-(2-ethoxyphenoxy)acetyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide (PubChem CID 55712443) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is N'-[2-(2-ethoxyphenoxy)acetyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide.
| Compound Name | N'-[2-(2-ethoxyphenoxy)acetyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55712443 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N'-[2-(2-ethoxyphenoxy)acetyl]-1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carbohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)C1CCCN(c2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H25F3N4O4/c1-2-32-17-9-3-4-10-18(17)33-14-19(30)27-28-21(31)15-7-6-12-29(13-15)20-16(22(23,24)25)8-5-11-26-20/h3-5,8-11,15H,2,6-7,12-14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | OBJKTVARFRAVBS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|