C18H19N3O4S — CID 46556792
N'-(2-hydroxybenzoyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide (PubChem CID 46556792) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N'-(2-hydroxybenzoyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | N'-(2-hydroxybenzoyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46556792 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N'-(2-hydroxybenzoyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(C(=O)c2cccs2)C1)c1ccccc1O |
| InChI | InChI=1S/C18H19N3O4S/c22-14-7-2-1-6-13(14)17(24)20-19-16(23)12-5-3-9-21(11-12)18(25)15-8-4-10-26-15/h1-2,4,6-8,10,12,22H,3,5,9,11H2,(H,19,23)(H,20,24) |
| InChIKey | AMFMOPMPIKTVLA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|