C16H17BrN4O3S — CID 55559155
N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide (PubChem CID 55559155) has the molecular formula C16H17BrN4O3S and a molecular weight of 425.31 g/mol. Its IUPAC name is N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55559155 |
| Molecular Formula | C16H17BrN4O3S |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-1-(thiophene-2-carbonyl)piperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(C(=O)c2cccs2)C1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C16H17BrN4O3S/c17-11-7-12(18-8-11)15(23)20-19-14(22)10-3-1-5-21(9-10)16(24)13-4-2-6-25-13/h2,4,6-8,10,18H,1,3,5,9H2,(H,19,22)(H,20,23) |
| InChIKey | MJKFBBUHAZPTNV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|