C19H27Cl2N5O — CID 119856952
N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119856952) has the molecular formula C19H27Cl2N5O and a molecular weight of 412.37 g/mol. Its IUPAC name is N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119856952 |
| Molecular Formula | C19H27Cl2N5O |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)C2CC3CCCCC3N2)c1.Cl.Cl |
| InChI | InChI=1S/C19H25N5O.2ClH/c1-2-24-12-20-23-18(24)14-7-5-8-15(10-14)21-19(25)17-11-13-6-3-4-9-16(13)22-17;;/h5,7-8,10,12-13,16-17,22H,2-4,6,9,11H2,1H3,(H,21,25);2*1H |
| InChIKey | ODJCJDLNEIYUKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |