C22H27ClN2O2 — CID 119281223
N-[3-(2-methoxyphenyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119281223) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is N-[3-(2-methoxyphenyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(2-methoxyphenyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119281223 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-(2-methoxyphenyl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COc1ccccc1-c1cccc(NC(=O)C2CC3CCCCC3N2)c1.Cl |
| InChI | InChI=1S/C22H26N2O2.ClH/c1-26-21-12-5-3-10-18(21)15-8-6-9-17(13-15)23-22(25)20-14-16-7-2-4-11-19(16)24-20;/h3,5-6,8-10,12-13,16,19-20,24H,2,4,7,11,14H2,1H3,(H,23,25);1H |
| InChIKey | ZALIMAIGBGWHGB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |