C16H17N5O — CID 98341302
(1R,2S,4S)-N-[3-(1-methyltetrazol-5-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98341302) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is (1R,2S,4S)-N-[3-(1-methyltetrazol-5-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-[3-(1-methyltetrazol-5-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98341302 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (1R,2S,4S)-N-[3-(1-methyltetrazol-5-yl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)[C@H]2C[C@H]3C=C[C@H]2C3)c1 |
| InChI | InChI=1S/C16H17N5O/c1-21-15(18-19-20-21)12-3-2-4-13(9-12)17-16(22)14-8-10-5-6-11(14)7-10/h2-6,9-11,14H,7-8H2,1H3,(H,17,22)/t10-,11-,14-/m0/s1 |
| InChIKey | PLJBJVMEAQMFOO-MJVIPROJSA-N |
| XLogP | 2.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|