C15H14N2O — CID 98368145
(1R,2R,4S)-N-(3-cyanophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98368145) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is (1R,2R,4S)-N-(3-cyanophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-(3-cyanophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98368145 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (1R,2R,4S)-N-(3-cyanophenyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)[C@@H]2C[C@H]3C=C[C@H]2C3)c1 |
| InChI | InChI=1S/C15H14N2O/c16-9-11-2-1-3-13(7-11)17-15(18)14-8-10-4-5-12(14)6-10/h1-5,7,10,12,14H,6,8H2,(H,17,18)/t10-,12-,14+/m0/s1 |
| InChIKey | FTWGUGCITXEVNU-VHRBIJSZSA-N |
| XLogP | 2.71 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|