C16H16N2O — CID 98787879
(1S,2R,4R,5S)-N-(3-cyanophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 98787879) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (1S,2R,4R,5S)-N-(3-cyanophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | (1S,2R,4R,5S)-N-(3-cyanophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 98787879 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (1S,2R,4R,5S)-N-(3-cyanophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)C2[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]23)c1 |
| InChI | InChI=1S/C16H16N2O/c17-8-9-2-1-3-12(6-9)18-16(19)15-13-10-4-5-11(7-10)14(13)15/h1-3,6,10-11,13-15H,4-5,7H2,(H,18,19)/t10-,11-,13+,14+/m0/s1 |
| InChIKey | QATPIIDOUNOPFC-CDGCEXEKSA-N |
| XLogP | 2.79 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |