C16H15FN2O — CID 103760902
N-(3-cyano-4-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 103760902) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 103760902 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | N#Cc1cc(NC(=O)C2C3C4CCC(C4)C23)ccc1F |
| InChI | InChI=1S/C16H15FN2O/c17-12-4-3-11(6-10(12)7-18)19-16(20)15-13-8-1-2-9(5-8)14(13)15/h3-4,6,8-9,13-15H,1-2,5H2,(H,19,20) |
| InChIKey | BAKRXJODEUXYKM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |