C14H16FN3O — CID 63044726
3-amino-N-(3-cyano-4-fluorophenyl)cyclohexane-1-carboxamide (PubChem CID 63044726) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-amino-N-(3-cyano-4-fluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-(3-cyano-4-fluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 63044726 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-amino-N-(3-cyano-4-fluorophenyl)cyclohexane-1-carboxamide |
| SMILES | N#Cc1cc(NC(=O)C2CCCC(N)C2)ccc1F |
| InChI | InChI=1S/C14H16FN3O/c15-13-5-4-12(7-10(13)8-16)18-14(19)9-2-1-3-11(17)6-9/h4-5,7,9,11H,1-3,6,17H2,(H,18,19) |
| InChIKey | CYFVTZFLIKETBF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |