C15H16N4O — CID 107790584
3-amino-N-(3,4-dicyanophenyl)cyclohexane-1-carboxamide (PubChem CID 107790584) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-amino-N-(3,4-dicyanophenyl)cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-(3,4-dicyanophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107790584 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-amino-N-(3,4-dicyanophenyl)cyclohexane-1-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CCCC(N)C2)cc1C#N |
| InChI | InChI=1S/C15H16N4O/c16-8-11-4-5-14(7-12(11)9-17)19-15(20)10-2-1-3-13(18)6-10/h4-5,7,10,13H,1-3,6,18H2,(H,19,20) |
| InChIKey | PDXIESBKNZSSID-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |