C13H16ClF3N2O — CID 119707997
3-amino-N-(3,4,5-trifluorophenyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119707997) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 3-amino-N-(3,4,5-trifluorophenyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(3,4,5-trifluorophenyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119707997 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-amino-N-(3,4,5-trifluorophenyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)Nc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C13H15F3N2O.ClH/c14-10-5-9(6-11(15)12(10)16)18-13(19)7-2-1-3-8(17)4-7;/h5-8H,1-4,17H2,(H,18,19);1H |
| InChIKey | UWJONTYIGRPQSK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|