C12H14ClF2IN2O — CID 119764593
3-amino-N-(3,5-difluoro-4-iodophenyl)cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119764593) has the molecular formula C12H14ClF2IN2O and a molecular weight of 402.61 g/mol. Its IUPAC name is 3-amino-N-(3,5-difluoro-4-iodophenyl)cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(3,5-difluoro-4-iodophenyl)cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119764593 |
| Molecular Formula | C12H14ClF2IN2O |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 3-amino-N-(3,5-difluoro-4-iodophenyl)cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)Nc2cc(F)c(I)c(F)c2)C1 |
| InChI | InChI=1S/C12H13F2IN2O.ClH/c13-9-4-8(5-10(14)11(9)15)17-12(18)6-1-2-7(16)3-6;/h4-7H,1-3,16H2,(H,17,18);1H |
| InChIKey | AREQHYWGPBDLHS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|