C15H16ClNO — CID 98252305
(1S,2R,4R,5S)-N-(4-chlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 98252305) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is (1S,2R,4R,5S)-N-(4-chlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | (1S,2R,4R,5S)-N-(4-chlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 98252305 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (1S,2R,4R,5S)-N-(4-chlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C15H16ClNO/c16-10-3-5-11(6-4-10)17-15(18)14-12-8-1-2-9(7-8)13(12)14/h3-6,8-9,12-14H,1-2,7H2,(H,17,18)/t8-,9-,12+,13+/m0/s1 |
| InChIKey | PVCPOUAXDFRYDJ-RBJBARPLSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |