C21H18Cl2N2O2 — CID 1100687
(1S,2S,3S,4R)-2-N,3-N-bis(4-chlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 1100687) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is (1S,2S,3S,4R)-2-N,3-N-bis(4-chlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1S,2S,3S,4R)-2-N,3-N-bis(4-chlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 1100687 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (1S,2S,3S,4R)-2-N,3-N-bis(4-chlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H]1[C@@H](C(=O)Nc2ccc(Cl)cc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C21H18Cl2N2O2/c22-14-3-7-16(8-4-14)24-20(26)18-12-1-2-13(11-12)19(18)21(27)25-17-9-5-15(23)6-10-17/h1-10,12-13,18-19H,11H2,(H,24,26)(H,25,27)/t12-,13+,18-,19-/m0/s1 |
| InChIKey | UBCQNAYMIJJLRK-ATNYCFDYSA-N |
| XLogP | 5.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|