C15H14NO4- — CID 11906785
(1R,2S,3R,4S)-3-[(4-hydroxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11906785) has the molecular formula C15H14NO4- and a molecular weight of 272.28 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(4-hydroxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-[(4-hydroxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11906785 |
| Molecular Formula | C15H14NO4- |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(4-hydroxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)Nc2ccc(O)cc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H15NO4/c17-11-5-3-10(4-6-11)16-14(18)12-8-1-2-9(7-8)13(12)15(19)20/h1-6,8-9,12-13,17H,7H2,(H,16,18)(H,19,20)/p-1/t8-,9+,12-,13+/m1/s1 |
| InChIKey | KSPCSLXTFYMKED-DTVLGXAZSA-M |
| XLogP | 0.52 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|