C15H12Br2NO3- — CID 11879889
(1R,2S,3S,4S)-3-[(3,4-dibromophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11879889) has the molecular formula C15H12Br2NO3- and a molecular weight of 414.07 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-[(3,4-dibromophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3S,4S)-3-[(3,4-dibromophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11879889 |
| Molecular Formula | C15H12Br2NO3- |
| Molecular Weight | 414.07 g/mol |
| Exact Mass | 411.92 |
| IUPAC Name | (1R,2S,3S,4S)-3-[(3,4-dibromophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Nc1ccc(Br)c(Br)c1)[C@@H]1[C@@H](C(=O)[O-])[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H13Br2NO3/c16-10-4-3-9(6-11(10)17)18-14(19)12-7-1-2-8(5-7)13(12)15(20)21/h1-4,6-8,12-13H,5H2,(H,18,19)(H,20,21)/p-1/t7-,8+,12+,13+/m1/s1 |
| InChIKey | KLVKTRVXZIEBTC-HTEOGMQZSA-M |
| XLogP | 2.34 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.07 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|