C15H13ClNO3- — CID 23308787
(1R,2S,3R,4R)-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23308787) has the molecular formula C15H13ClNO3- and a molecular weight of 290.73 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4R)-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 23308787 |
| Molecular Formula | C15H13ClNO3- |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (1R,2S,3R,4R)-3-[(3-chlorophenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)Nc2cccc(Cl)c2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H14ClNO3/c16-10-2-1-3-11(7-10)17-14(18)12-8-4-5-9(6-8)13(12)15(19)20/h1-5,7-9,12-13H,6H2,(H,17,18)(H,19,20)/p-1/t8-,9-,12+,13-/m0/s1 |
| InChIKey | COXGMHOTCMIWCZ-NGERZBJRSA-M |
| XLogP | 1.47 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|